C18H27N3O3S2 — CID 7621301
(12S)-5-(2,2-diethoxyethylsulfanyl)-12-ethyl-12-methyl-11-oxa-8-thia-4,6-diazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-amine (PubChem CID 7621301) has the molecular formula C18H27N3O3S2 and a molecular weight of 397.57 g/mol. Its IUPAC name is (12S)-5-(2,2-diethoxyethylsulfanyl)-12-ethyl-12-methyl-11-oxa-8-thia-4,6-diazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-amine.
| Compound Name | (12S)-5-(2,2-diethoxyethylsulfanyl)-12-ethyl-12-methyl-11-oxa-8-thia-4,6-diazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-amine |
|---|---|
| PubChem CID | 7621301 |
| Molecular Formula | C18H27N3O3S2 |
| Molecular Weight | 397.57 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | (12S)-5-(2,2-diethoxyethylsulfanyl)-12-ethyl-12-methyl-11-oxa-8-thia-4,6-diazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-amine |
| SMILES | CCOC(CSc1nc(N)c2c3c(sc2n1)CO[C@@](C)(CC)C3)OCC |
| InChI | InChI=1S/C18H27N3O3S2/c1-5-18(4)8-11-12(9-24-18)26-16-14(11)15(19)20-17(21-16)25-10-13(22-6-2)23-7-3/h13H,5-10H2,1-4H3,(H2,19,20,21)/t18-/m0/s1 |
| InChIKey | UDTGAOGQBOMWEE-SFHVURJKSA-N |
| XLogP | 4.01 |
| TPSA | 79.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.57 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|