About CID 76219072
CID 76219072 (PubChem CID 76219072) has the molecular formula C8H17NO
and a molecular weight of 143.23 g/mol. Its IUPAC name is 2-aminooct-4-en-1-ol.
Molecular Properties
| Compound Name | CID 76219072 |
| PubChem CID | 76219072 |
| Molecular Formula | C8H17NO |
| Molecular Weight | 143.23 g/mol |
| Exact Mass | 143.13 |
| IUPAC Name | 2-aminooct-4-en-1-ol |
| SMILES | CCCC=CCC(CO)N |
| InChI | InChI=1S/C8H17NO/c1-2-3-4-5-6-8(9)7-10/h4-5,8,10H,2-3,6-7,9H2,1H3 |
| InChIKey | NQYMRPAYIXOQLW-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 46.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | 91 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.23 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze CID 76219072 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 76219072?
The IUPAC name of CID 76219072 (CID 76219072) is 2-aminooct-4-en-1-ol.
What is the SMILES notation for CID 76219072?
The canonical SMILES for CID 76219072 is CCCC=CCC(CO)N.
What is the InChIKey of CID 76219072?
The InChIKey is NQYMRPAYIXOQLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17NO/c1-2-3-4-5-6-8(9)7-10/h4-5,8,10H,2-3,6-7,9H2,1H3.
What are the key properties of CID 76219072?
CID 76219072 has a molecular weight of 143.23 g/mol, XLogP of 1.00, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 76219072 is sourced from PubChem (CID 76219072), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).