C17H24N3O2S+ — CID 7622271
N-(1,3-benzothiazol-2-yl)-N-(2-morpholin-4-ium-4-ylethyl)butanamide (PubChem CID 7622271) has the molecular formula C17H24N3O2S+ and a molecular weight of 334.46 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yl)-N-(2-morpholin-4-ium-4-ylethyl)butanamide.
| Compound Name | N-(1,3-benzothiazol-2-yl)-N-(2-morpholin-4-ium-4-ylethyl)butanamide |
|---|---|
| PubChem CID | 7622271 |
| Molecular Formula | C17H24N3O2S+ |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.16 |
| IUPAC Name | N-(1,3-benzothiazol-2-yl)-N-(2-morpholin-4-ium-4-ylethyl)butanamide |
| SMILES | CCCC(=O)N(CC[NH+]1CCOCC1)c1nc2ccccc2s1 |
| InChI | InChI=1S/C17H23N3O2S/c1-2-5-16(21)20(9-8-19-10-12-22-13-11-19)17-18-14-6-3-4-7-15(14)23-17/h3-4,6-7H,2,5,8-13H2,1H3/p+1 |
| InChIKey | PFRWHWLHWZFOIO-UHFFFAOYSA-O |
| XLogP | 1.34 |
| TPSA | 46.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |