C18H15ClN4O — CID 7623083
4-[(1S)-2-(4-chlorophenyl)-3-oxo-1,5,6,7-tetrahydropyrazolo[1,2-a][1,2,4]triazol-1-yl]benzonitrile (PubChem CID 7623083) has the molecular formula C18H15ClN4O and a molecular weight of 338.80 g/mol. Its IUPAC name is 4-[(1S)-2-(4-chlorophenyl)-3-oxo-1,5,6,7-tetrahydropyrazolo[1,2-a][1,2,4]triazol-1-yl]benzonitrile.
| Compound Name | 4-[(1S)-2-(4-chlorophenyl)-3-oxo-1,5,6,7-tetrahydropyrazolo[1,2-a][1,2,4]triazol-1-yl]benzonitrile |
|---|---|
| PubChem CID | 7623083 |
| Molecular Formula | C18H15ClN4O |
| Molecular Weight | 338.80 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | 4-[(1S)-2-(4-chlorophenyl)-3-oxo-1,5,6,7-tetrahydropyrazolo[1,2-a][1,2,4]triazol-1-yl]benzonitrile |
| SMILES | N#Cc1ccc([C@H]2N(c3ccc(Cl)cc3)C(=O)N3CCCN23)cc1 |
| InChI | InChI=1S/C18H15ClN4O/c19-15-6-8-16(9-7-15)23-17(14-4-2-13(12-20)3-5-14)21-10-1-11-22(21)18(23)24/h2-9,17H,1,10-11H2/t17-/m1/s1 |
| InChIKey | CBVCWGJAZBAFHA-QGZVFWFLSA-N |
| XLogP | 3.77 |
| TPSA | 50.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.80 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |