C19H20FNO5S — CID 7624083
[(2S)-1-(N-methylanilino)-1-oxopropan-2-yl] 3-(4-fluorophenyl)sulfonylpropanoate (PubChem CID 7624083) has the molecular formula C19H20FNO5S and a molecular weight of 393.44 g/mol. Its IUPAC name is [(2S)-1-(N-methylanilino)-1-oxopropan-2-yl] 3-(4-fluorophenyl)sulfonylpropanoate.
| Compound Name | [(2S)-1-(N-methylanilino)-1-oxopropan-2-yl] 3-(4-fluorophenyl)sulfonylpropanoate |
|---|---|
| PubChem CID | 7624083 |
| Molecular Formula | C19H20FNO5S |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.10 |
| IUPAC Name | [(2S)-1-(N-methylanilino)-1-oxopropan-2-yl] 3-(4-fluorophenyl)sulfonylpropanoate |
| SMILES | C[C@H](OC(=O)CCS(=O)(=O)c1ccc(F)cc1)C(=O)N(C)c1ccccc1 |
| InChI | InChI=1S/C19H20FNO5S/c1-14(19(23)21(2)16-6-4-3-5-7-16)26-18(22)12-13-27(24,25)17-10-8-15(20)9-11-17/h3-11,14H,12-13H2,1-2H3/t14-/m0/s1 |
| InChIKey | SDXFHWXPZMJGLP-AWEZNQCLSA-N |
| XLogP | 2.58 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |