C13H9Cl2N5OS — CID 7624317
2-[(6-chloro-1H-imidazo[4,5-b]pyridin-2-yl)sulfanyl]-N-(2-chloro-3-pyridinyl)acetamide (PubChem CID 7624317) has the molecular formula C13H9Cl2N5OS and a molecular weight of 354.22 g/mol. Its IUPAC name is 2-[(6-chloro-1H-imidazo[4,5-b]pyridin-2-yl)sulfanyl]-N-(2-chloro-3-pyridinyl)acetamide.
| Compound Name | 2-[(6-chloro-1H-imidazo[4,5-b]pyridin-2-yl)sulfanyl]-N-(2-chloro-3-pyridinyl)acetamide |
|---|---|
| PubChem CID | 7624317 |
| Molecular Formula | C13H9Cl2N5OS |
| Molecular Weight | 354.22 g/mol |
| Exact Mass | 352.99 |
| IUPAC Name | 2-[(6-chloro-1H-imidazo[4,5-b]pyridin-2-yl)sulfanyl]-N-(2-chloro-3-pyridinyl)acetamide |
| SMILES | O=C(CSc1nc2ncc(Cl)cc2[nH]1)Nc1cccnc1Cl |
| InChI | InChI=1S/C13H9Cl2N5OS/c14-7-4-9-12(17-5-7)20-13(19-9)22-6-10(21)18-8-2-1-3-16-11(8)15/h1-5H,6H2,(H,18,21)(H,17,19,20) |
| InChIKey | UBDUCMSKVXXJQZ-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.22 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|