About 2-(2,2-dimethylpropanoylamino)-5-phenylthiophene-3-carboxylic acid
2-(2,2-dimethylpropanoylamino)-5-phenylthiophene-3-carboxylic acid (PubChem CID 762466) has the molecular formula C16H17NO3S
and a molecular weight of 303.38 g/mol. Its IUPAC name is 2-(2,2-dimethylpropanoylamino)-5-phenylthiophene-3-carboxylic acid.
Molecular Properties
| Compound Name | 2-(2,2-dimethylpropanoylamino)-5-phenylthiophene-3-carboxylic acid |
| PubChem CID | 762466 |
| Molecular Formula | C16H17NO3S |
| Molecular Weight | 303.38 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | 2-(2,2-dimethylpropanoylamino)-5-phenylthiophene-3-carboxylic acid |
| SMILES | CC(C)(C)C(=O)Nc1sc(-c2ccccc2)cc1C(=O)O |
| InChI | InChI=1S/C16H17NO3S/c1-16(2,3)15(20)17-13-11(14(18)19)9-12(21-13)10-7-5-4-6-8-10/h4-9H,1-3H3,(H,17,20)(H,18,19) |
| InChIKey | FYSJMBFGDRCTPR-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.38 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiophene_amino_G(2)', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,2-dimethylpropanoylamino)-5-phenylthiophene-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,2-dimethylpropanoylamino)-5-phenylthiophene-3-carboxylic acid?
The IUPAC name of 2-(2,2-dimethylpropanoylamino)-5-phenylthiophene-3-carboxylic acid (CID 762466) is 2-(2,2-dimethylpropanoylamino)-5-phenylthiophene-3-carboxylic acid.
What is the SMILES notation for 2-(2,2-dimethylpropanoylamino)-5-phenylthiophene-3-carboxylic acid?
The canonical SMILES for 2-(2,2-dimethylpropanoylamino)-5-phenylthiophene-3-carboxylic acid is CC(C)(C)C(=O)Nc1sc(-c2ccccc2)cc1C(=O)O.
What is the InChIKey of 2-(2,2-dimethylpropanoylamino)-5-phenylthiophene-3-carboxylic acid?
The InChIKey is FYSJMBFGDRCTPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17NO3S/c1-16(2,3)15(20)17-13-11(14(18)19)9-12(21-13)10-7-5-4-6-8-10/h4-9H,1-3H3,(H,17,20)(H,18,19).
What are the key properties of 2-(2,2-dimethylpropanoylamino)-5-phenylthiophene-3-carboxylic acid?
2-(2,2-dimethylpropanoylamino)-5-phenylthiophene-3-carboxylic acid has a molecular weight of 303.38 g/mol, XLogP of 4.10, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,2-dimethylpropanoylamino)-5-phenylthiophene-3-carboxylic acid is sourced from PubChem (CID 762466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).