C20H20N2O6S — CID 7625048
[(1R)-1-(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)ethyl] 2-(4-formyl-2-methoxyphenoxy)acetate (PubChem CID 7625048) has the molecular formula C20H20N2O6S and a molecular weight of 416.46 g/mol. Its IUPAC name is [(1R)-1-(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)ethyl] 2-(4-formyl-2-methoxyphenoxy)acetate.
| Compound Name | [(1R)-1-(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)ethyl] 2-(4-formyl-2-methoxyphenoxy)acetate |
|---|---|
| PubChem CID | 7625048 |
| Molecular Formula | C20H20N2O6S |
| Molecular Weight | 416.46 g/mol |
| Exact Mass | 416.10 |
| IUPAC Name | [(1R)-1-(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)ethyl] 2-(4-formyl-2-methoxyphenoxy)acetate |
| SMILES | COc1cc(C=O)ccc1OCC(=O)O[C@H](C)c1nc2sc(C)c(C)c2c(=O)[nH]1 |
| InChI | InChI=1S/C20H20N2O6S/c1-10-12(3)29-20-17(10)19(25)21-18(22-20)11(2)28-16(24)9-27-14-6-5-13(8-23)7-15(14)26-4/h5-8,11H,9H2,1-4H3,(H,21,22,25)/t11-/m1/s1 |
| InChIKey | SUCXQEXDBHUKIJ-LLVKDONJSA-N |
| XLogP | 3.11 |
| TPSA | 107.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.46 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|