C19H22ClN5O — CID 7626634
4-chloro-N-[3-(dimethylamino)propyl]-3-methyl-1-phenylpyrazolo[3,4-b]pyridine-5-carboxamide (PubChem CID 7626634) has the molecular formula C19H22ClN5O and a molecular weight of 371.87 g/mol. Its IUPAC name is 4-chloro-N-[3-(dimethylamino)propyl]-3-methyl-1-phenylpyrazolo[3,4-b]pyridine-5-carboxamide.
| Compound Name | 4-chloro-N-[3-(dimethylamino)propyl]-3-methyl-1-phenylpyrazolo[3,4-b]pyridine-5-carboxamide |
|---|---|
| PubChem CID | 7626634 |
| Molecular Formula | C19H22ClN5O |
| Molecular Weight | 371.87 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | 4-chloro-N-[3-(dimethylamino)propyl]-3-methyl-1-phenylpyrazolo[3,4-b]pyridine-5-carboxamide |
| SMILES | Cc1nn(-c2ccccc2)c2ncc(C(=O)NCCCN(C)C)c(Cl)c12 |
| InChI | InChI=1S/C19H22ClN5O/c1-13-16-17(20)15(19(26)21-10-7-11-24(2)3)12-22-18(16)25(23-13)14-8-5-4-6-9-14/h4-6,8-9,12H,7,10-11H2,1-3H3,(H,21,26) |
| InChIKey | VAYUIFGHDSNKLS-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.87 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|