About (2-methoxy-5-methylphenyl)methyl 4-acetyl-3,5-dimethyl-1H-pyrrole-2-carboxylate
(2-methoxy-5-methylphenyl)methyl 4-acetyl-3,5-dimethyl-1H-pyrrole-2-carboxylate (PubChem CID 7626706) has the molecular formula C18H21NO4
and a molecular weight of 315.37 g/mol. Its IUPAC name is (2-methoxy-5-methylphenyl)methyl 4-acetyl-3,5-dimethyl-1H-pyrrole-2-carboxylate.
Molecular Properties
| Compound Name | (2-methoxy-5-methylphenyl)methyl 4-acetyl-3,5-dimethyl-1H-pyrrole-2-carboxylate |
| PubChem CID | 7626706 |
| Molecular Formula | C18H21NO4 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | (2-methoxy-5-methylphenyl)methyl 4-acetyl-3,5-dimethyl-1H-pyrrole-2-carboxylate |
| SMILES | COc1ccc(C)cc1COC(=O)c1[nH]c(C)c(C(C)=O)c1C |
| InChI | InChI=1S/C18H21NO4/c1-10-6-7-15(22-5)14(8-10)9-23-18(21)17-11(2)16(13(4)20)12(3)19-17/h6-8,19H,9H2,1-5H3 |
| InChIKey | KFQAQKPVVXMFDE-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 68.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2-methoxy-5-methylphenyl)methyl 4-acetyl-3,5-dimethyl-1H-pyrrole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methoxy-5-methylphenyl)methyl 4-acetyl-3,5-dimethyl-1H-pyrrole-2-carboxylate?
The IUPAC name of (2-methoxy-5-methylphenyl)methyl 4-acetyl-3,5-dimethyl-1H-pyrrole-2-carboxylate (CID 7626706) is (2-methoxy-5-methylphenyl)methyl 4-acetyl-3,5-dimethyl-1H-pyrrole-2-carboxylate.
What is the SMILES notation for (2-methoxy-5-methylphenyl)methyl 4-acetyl-3,5-dimethyl-1H-pyrrole-2-carboxylate?
The canonical SMILES for (2-methoxy-5-methylphenyl)methyl 4-acetyl-3,5-dimethyl-1H-pyrrole-2-carboxylate is COc1ccc(C)cc1COC(=O)c1[nH]c(C)c(C(C)=O)c1C.
What is the InChIKey of (2-methoxy-5-methylphenyl)methyl 4-acetyl-3,5-dimethyl-1H-pyrrole-2-carboxylate?
The InChIKey is KFQAQKPVVXMFDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21NO4/c1-10-6-7-15(22-5)14(8-10)9-23-18(21)17-11(2)16(13(4)20)12(3)19-17/h6-8,19H,9H2,1-5H3.
What are the key properties of (2-methoxy-5-methylphenyl)methyl 4-acetyl-3,5-dimethyl-1H-pyrrole-2-carboxylate?
(2-methoxy-5-methylphenyl)methyl 4-acetyl-3,5-dimethyl-1H-pyrrole-2-carboxylate has a molecular weight of 315.37 g/mol, XLogP of 3.51, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methoxy-5-methylphenyl)methyl 4-acetyl-3,5-dimethyl-1H-pyrrole-2-carboxylate is sourced from PubChem (CID 7626706), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).