About 5,7-dimethylquinolin-8-ol
5,7-dimethylquinolin-8-ol (PubChem CID 762732) has the molecular formula C11H11NO
and a molecular weight of 173.21 g/mol. Its IUPAC name is 5,7-dimethylquinolin-8-ol.
Molecular Properties
| Compound Name | 5,7-dimethylquinolin-8-ol |
| PubChem CID | 762732 |
| Molecular Formula | C11H11NO |
| Molecular Weight | 173.21 g/mol |
| Exact Mass | 173.08 |
| IUPAC Name | 5,7-dimethylquinolin-8-ol |
| SMILES | Cc1cc(C)c2cccnc2c1O |
| InChI | InChI=1S/C11H11NO/c1-7-6-8(2)11(13)10-9(7)4-3-5-12-10/h3-6,13H,1-2H3 |
| InChIKey | UKWMNFHGYXRSFQ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.21 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5,7-dimethylquinolin-8-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,7-dimethylquinolin-8-ol?
The IUPAC name of 5,7-dimethylquinolin-8-ol (CID 762732) is 5,7-dimethylquinolin-8-ol.
What is the SMILES notation for 5,7-dimethylquinolin-8-ol?
The canonical SMILES for 5,7-dimethylquinolin-8-ol is Cc1cc(C)c2cccnc2c1O.
What is the InChIKey of 5,7-dimethylquinolin-8-ol?
The InChIKey is UKWMNFHGYXRSFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NO/c1-7-6-8(2)11(13)10-9(7)4-3-5-12-10/h3-6,13H,1-2H3.
What are the key properties of 5,7-dimethylquinolin-8-ol?
5,7-dimethylquinolin-8-ol has a molecular weight of 173.21 g/mol, XLogP of 2.56, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,7-dimethylquinolin-8-ol is sourced from PubChem (CID 762732), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).