About 2-hydroxy-1-morpholin-4-yl-2,2-diphenylethanone
2-hydroxy-1-morpholin-4-yl-2,2-diphenylethanone (PubChem CID 762749) has the molecular formula C18H19NO3
and a molecular weight of 297.35 g/mol. Its IUPAC name is 2-hydroxy-1-morpholin-4-yl-2,2-diphenylethanone.
Molecular Properties
| Compound Name | 2-hydroxy-1-morpholin-4-yl-2,2-diphenylethanone |
| PubChem CID | 762749 |
| Molecular Formula | C18H19NO3 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | 2-hydroxy-1-morpholin-4-yl-2,2-diphenylethanone |
| SMILES | O=C(N1CCOCC1)C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H19NO3/c20-17(19-11-13-22-14-12-19)18(21,15-7-3-1-4-8-15)16-9-5-2-6-10-16/h1-10,21H,11-14H2 |
| InChIKey | PRLJMJKMDUTMIO-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-hydroxy-1-morpholin-4-yl-2,2-diphenylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-1-morpholin-4-yl-2,2-diphenylethanone?
The IUPAC name of 2-hydroxy-1-morpholin-4-yl-2,2-diphenylethanone (CID 762749) is 2-hydroxy-1-morpholin-4-yl-2,2-diphenylethanone.
What is the SMILES notation for 2-hydroxy-1-morpholin-4-yl-2,2-diphenylethanone?
The canonical SMILES for 2-hydroxy-1-morpholin-4-yl-2,2-diphenylethanone is O=C(N1CCOCC1)C(O)(c1ccccc1)c1ccccc1.
What is the InChIKey of 2-hydroxy-1-morpholin-4-yl-2,2-diphenylethanone?
The InChIKey is PRLJMJKMDUTMIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19NO3/c20-17(19-11-13-22-14-12-19)18(21,15-7-3-1-4-8-15)16-9-5-2-6-10-16/h1-10,21H,11-14H2.
What are the key properties of 2-hydroxy-1-morpholin-4-yl-2,2-diphenylethanone?
2-hydroxy-1-morpholin-4-yl-2,2-diphenylethanone has a molecular weight of 297.35 g/mol, XLogP of 1.78, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-1-morpholin-4-yl-2,2-diphenylethanone is sourced from PubChem (CID 762749), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).