C12H14N2O5S2 — CID 762871
8-hydroxy-1-N,6-N-dimethylnaphthalene-1,6-disulfonamide (PubChem CID 762871) has the molecular formula C12H14N2O5S2 and a molecular weight of 330.39 g/mol. Its IUPAC name is 8-hydroxy-1-N,6-N-dimethylnaphthalene-1,6-disulfonamide.
| Compound Name | 8-hydroxy-1-N,6-N-dimethylnaphthalene-1,6-disulfonamide |
|---|---|
| PubChem CID | 762871 |
| Molecular Formula | C12H14N2O5S2 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.03 |
| IUPAC Name | 8-hydroxy-1-N,6-N-dimethylnaphthalene-1,6-disulfonamide |
| SMILES | CNS(=O)(=O)c1cc(O)c2c(S(=O)(=O)NC)cccc2c1 |
| InChI | InChI=1S/C12H14N2O5S2/c1-13-20(16,17)9-6-8-4-3-5-11(21(18,19)14-2)12(8)10(15)7-9/h3-7,13-15H,1-2H3 |
| InChIKey | HVFCTDHBZZBQRF-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |