C12H9F4NO2 — CID 762945
4-methyl-2-[3-(1,1,2,2-tetrafluoroethyl)-1,2-oxazol-5-yl]phenol (PubChem CID 762945) has the molecular formula C12H9F4NO2 and a molecular weight of 275.20 g/mol. Its IUPAC name is 4-methyl-2-[3-(1,1,2,2-tetrafluoroethyl)-1,2-oxazol-5-yl]phenol.
| Compound Name | 4-methyl-2-[3-(1,1,2,2-tetrafluoroethyl)-1,2-oxazol-5-yl]phenol |
|---|---|
| PubChem CID | 762945 |
| Molecular Formula | C12H9F4NO2 |
| Molecular Weight | 275.20 g/mol |
| Exact Mass | 275.06 |
| IUPAC Name | 4-methyl-2-[3-(1,1,2,2-tetrafluoroethyl)-1,2-oxazol-5-yl]phenol |
| SMILES | Cc1ccc(O)c(-c2cc(C(F)(F)C(F)F)no2)c1 |
| InChI | InChI=1S/C12H9F4NO2/c1-6-2-3-8(18)7(4-6)9-5-10(17-19-9)12(15,16)11(13)14/h2-5,11,18H,1H3 |
| InChIKey | PWZMDKNCLKKEGW-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.20 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|