About ethyl 2-[10-(2-ethoxy-2-oxoethyl)-1,7-dioxa-4,10-diazacyclododec-4-yl]acetate
ethyl 2-[10-(2-ethoxy-2-oxoethyl)-1,7-dioxa-4,10-diazacyclododec-4-yl]acetate (PubChem CID 762955) has the molecular formula C16H30N2O6
and a molecular weight of 346.42 g/mol. Its IUPAC name is ethyl 2-[10-(2-ethoxy-2-oxoethyl)-1,7-dioxa-4,10-diazacyclododec-4-yl]acetate.
Molecular Properties
| Compound Name | ethyl 2-[10-(2-ethoxy-2-oxoethyl)-1,7-dioxa-4,10-diazacyclododec-4-yl]acetate |
| PubChem CID | 762955 |
| Molecular Formula | C16H30N2O6 |
| Molecular Weight | 346.42 g/mol |
| Exact Mass | 346.21 |
| IUPAC Name | ethyl 2-[10-(2-ethoxy-2-oxoethyl)-1,7-dioxa-4,10-diazacyclododec-4-yl]acetate |
| SMILES | CCOC(=O)CN1CCOCCN(CC(=O)OCC)CCOCC1 |
| InChI | InChI=1S/C16H30N2O6/c1-3-23-15(19)13-17-5-9-21-11-7-18(8-12-22-10-6-17)14-16(20)24-4-2/h3-14H2,1-2H3 |
| InChIKey | WAZKGEQZEWOVPR-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 77.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.42 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze ethyl 2-[10-(2-ethoxy-2-oxoethyl)-1,7-dioxa-4,10-diazacyclododec-4-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[10-(2-ethoxy-2-oxoethyl)-1,7-dioxa-4,10-diazacyclododec-4-yl]acetate?
The IUPAC name of ethyl 2-[10-(2-ethoxy-2-oxoethyl)-1,7-dioxa-4,10-diazacyclododec-4-yl]acetate (CID 762955) is ethyl 2-[10-(2-ethoxy-2-oxoethyl)-1,7-dioxa-4,10-diazacyclododec-4-yl]acetate.
What is the SMILES notation for ethyl 2-[10-(2-ethoxy-2-oxoethyl)-1,7-dioxa-4,10-diazacyclododec-4-yl]acetate?
The canonical SMILES for ethyl 2-[10-(2-ethoxy-2-oxoethyl)-1,7-dioxa-4,10-diazacyclododec-4-yl]acetate is CCOC(=O)CN1CCOCCN(CC(=O)OCC)CCOCC1.
What is the InChIKey of ethyl 2-[10-(2-ethoxy-2-oxoethyl)-1,7-dioxa-4,10-diazacyclododec-4-yl]acetate?
The InChIKey is WAZKGEQZEWOVPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H30N2O6/c1-3-23-15(19)13-17-5-9-21-11-7-18(8-12-22-10-6-17)14-16(20)24-4-2/h3-14H2,1-2H3.
What are the key properties of ethyl 2-[10-(2-ethoxy-2-oxoethyl)-1,7-dioxa-4,10-diazacyclododec-4-yl]acetate?
ethyl 2-[10-(2-ethoxy-2-oxoethyl)-1,7-dioxa-4,10-diazacyclododec-4-yl]acetate has a molecular weight of 346.42 g/mol, XLogP of -0.24, 6 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[10-(2-ethoxy-2-oxoethyl)-1,7-dioxa-4,10-diazacyclododec-4-yl]acetate is sourced from PubChem (CID 762955), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).