C21H17FN2OS2 — CID 7630827
6-(4-fluorophenyl)-4-(3-phenoxypropylsulfanyl)thieno[3,2-d]pyrimidine (PubChem CID 7630827) has the molecular formula C21H17FN2OS2 and a molecular weight of 396.51 g/mol. Its IUPAC name is 6-(4-fluorophenyl)-4-(3-phenoxypropylsulfanyl)thieno[3,2-d]pyrimidine.
| Compound Name | 6-(4-fluorophenyl)-4-(3-phenoxypropylsulfanyl)thieno[3,2-d]pyrimidine |
|---|---|
| PubChem CID | 7630827 |
| Molecular Formula | C21H17FN2OS2 |
| Molecular Weight | 396.51 g/mol |
| Exact Mass | 396.08 |
| IUPAC Name | 6-(4-fluorophenyl)-4-(3-phenoxypropylsulfanyl)thieno[3,2-d]pyrimidine |
| SMILES | Fc1ccc(-c2cc3ncnc(SCCCOc4ccccc4)c3s2)cc1 |
| InChI | InChI=1S/C21H17FN2OS2/c22-16-9-7-15(8-10-16)19-13-18-20(27-19)21(24-14-23-18)26-12-4-11-25-17-5-2-1-3-6-17/h1-3,5-10,13-14H,4,11-12H2 |
| InChIKey | LADNGXVYMMQLAQ-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.51 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|