C15H18N2O5S — CID 7632012
[2-[(4-methoxyphenyl)methylamino]-2-oxoethyl] 2-(2-oxo-1,3-thiazolidin-3-yl)acetate (PubChem CID 7632012) has the molecular formula C15H18N2O5S and a molecular weight of 338.38 g/mol. Its IUPAC name is [2-[(4-methoxyphenyl)methylamino]-2-oxoethyl] 2-(2-oxo-1,3-thiazolidin-3-yl)acetate.
| Compound Name | [2-[(4-methoxyphenyl)methylamino]-2-oxoethyl] 2-(2-oxo-1,3-thiazolidin-3-yl)acetate |
|---|---|
| PubChem CID | 7632012 |
| Molecular Formula | C15H18N2O5S |
| Molecular Weight | 338.38 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | [2-[(4-methoxyphenyl)methylamino]-2-oxoethyl] 2-(2-oxo-1,3-thiazolidin-3-yl)acetate |
| SMILES | COc1ccc(CNC(=O)COC(=O)CN2CCSC2=O)cc1 |
| InChI | InChI=1S/C15H18N2O5S/c1-21-12-4-2-11(3-5-12)8-16-13(18)10-22-14(19)9-17-6-7-23-15(17)20/h2-5H,6-10H2,1H3,(H,16,18) |
| InChIKey | ADCXTKGWZKDVIB-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.38 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|