C22H28N5O+ — CID 7632059
4-[2-(7,11-dimethyl-10-phenyl-1,3,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraen-3-yl)ethyl]morpholin-4-ium (PubChem CID 7632059) has the molecular formula C22H28N5O+ and a molecular weight of 378.50 g/mol. Its IUPAC name is 4-[2-(7,11-dimethyl-10-phenyl-1,3,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraen-3-yl)ethyl]morpholin-4-ium.
| Compound Name | 4-[2-(7,11-dimethyl-10-phenyl-1,3,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraen-3-yl)ethyl]morpholin-4-ium |
|---|---|
| PubChem CID | 7632059 |
| Molecular Formula | C22H28N5O+ |
| Molecular Weight | 378.50 g/mol |
| Exact Mass | 378.23 |
| IUPAC Name | 4-[2-(7,11-dimethyl-10-phenyl-1,3,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraen-3-yl)ethyl]morpholin-4-ium |
| SMILES | Cc1nc2c(-c3ccccc3)c(C)nn2c2c1CCN2CC[NH+]1CCOCC1 |
| InChI | InChI=1S/C22H27N5O/c1-16-19-8-9-26(11-10-25-12-14-28-15-13-25)22(19)27-21(23-16)20(17(2)24-27)18-6-4-3-5-7-18/h3-7H,8-15H2,1-2H3/p+1 |
| InChIKey | POHYOIHSAQYODW-UHFFFAOYSA-O |
| XLogP | 1.29 |
| TPSA | 47.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.50 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |