About (3R)-9-methyl-3,4-dihydro-2H-pyrido[1,2-a]pyrimidin-3-ol
(3R)-9-methyl-3,4-dihydro-2H-pyrido[1,2-a]pyrimidin-3-ol (PubChem CID 763215) has the molecular formula C9H12N2O
and a molecular weight of 164.21 g/mol. Its IUPAC name is (3R)-9-methyl-3,4-dihydro-2H-pyrido[1,2-a]pyrimidin-3-ol.
Molecular Properties
| Compound Name | (3R)-9-methyl-3,4-dihydro-2H-pyrido[1,2-a]pyrimidin-3-ol |
| PubChem CID | 763215 |
| Molecular Formula | C9H12N2O |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.09 |
| IUPAC Name | (3R)-9-methyl-3,4-dihydro-2H-pyrido[1,2-a]pyrimidin-3-ol |
| SMILES | CC1=CC=CN2C[C@H](O)CN=C12 |
| InChI | InChI=1S/C9H12N2O/c1-7-3-2-4-11-6-8(12)5-10-9(7)11/h2-4,8,12H,5-6H2,1H3/t8-/m1/s1 |
| InChIKey | DELOXTZBUOKDFV-MRVPVSSYSA-N |
| XLogP | 0.54 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3R)-9-methyl-3,4-dihydro-2H-pyrido[1,2-a]pyrimidin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-9-methyl-3,4-dihydro-2H-pyrido[1,2-a]pyrimidin-3-ol?
The IUPAC name of (3R)-9-methyl-3,4-dihydro-2H-pyrido[1,2-a]pyrimidin-3-ol (CID 763215) is (3R)-9-methyl-3,4-dihydro-2H-pyrido[1,2-a]pyrimidin-3-ol.
What is the SMILES notation for (3R)-9-methyl-3,4-dihydro-2H-pyrido[1,2-a]pyrimidin-3-ol?
The canonical SMILES for (3R)-9-methyl-3,4-dihydro-2H-pyrido[1,2-a]pyrimidin-3-ol is CC1=CC=CN2C[C@H](O)CN=C12.
What is the InChIKey of (3R)-9-methyl-3,4-dihydro-2H-pyrido[1,2-a]pyrimidin-3-ol?
The InChIKey is DELOXTZBUOKDFV-MRVPVSSYSA-N. The full InChI is InChI=1S/C9H12N2O/c1-7-3-2-4-11-6-8(12)5-10-9(7)11/h2-4,8,12H,5-6H2,1H3/t8-/m1/s1.
What are the key properties of (3R)-9-methyl-3,4-dihydro-2H-pyrido[1,2-a]pyrimidin-3-ol?
(3R)-9-methyl-3,4-dihydro-2H-pyrido[1,2-a]pyrimidin-3-ol has a molecular weight of 164.21 g/mol, XLogP of 0.54, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-9-methyl-3,4-dihydro-2H-pyrido[1,2-a]pyrimidin-3-ol is sourced from PubChem (CID 763215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).