C19H27N3O3S2 — CID 7632315
N-[(3aR,6aS)-3-[4-(dimethylamino)phenyl]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-3,3-dimethylbutanamide (PubChem CID 7632315) has the molecular formula C19H27N3O3S2 and a molecular weight of 409.58 g/mol. Its IUPAC name is N-[(3aR,6aS)-3-[4-(dimethylamino)phenyl]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-3,3-dimethylbutanamide.
| Compound Name | N-[(3aR,6aS)-3-[4-(dimethylamino)phenyl]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 7632315 |
| Molecular Formula | C19H27N3O3S2 |
| Molecular Weight | 409.58 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | N-[(3aR,6aS)-3-[4-(dimethylamino)phenyl]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-3,3-dimethylbutanamide |
| SMILES | CN(C)c1ccc(N2/C(=N/C(=O)CC(C)(C)C)S[C@@H]3CS(=O)(=O)C[C@H]32)cc1 |
| InChI | InChI=1S/C19H27N3O3S2/c1-19(2,3)10-17(23)20-18-22(14-8-6-13(7-9-14)21(4)5)15-11-27(24,25)12-16(15)26-18/h6-9,15-16H,10-12H2,1-5H3/b20-18-/t15-,16-/m1/s1 |
| InChIKey | KTACRQANPGRXGS-YUMLTWSLSA-N |
| XLogP | 2.79 |
| TPSA | 70.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.58 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|