C20H28ClNO — CID 7632387
(3R)-N-[(1R)-1-(4-chlorophenyl)ethyl]-3-(furan-2-yl)-6-methylheptan-1-amine (PubChem CID 7632387) has the molecular formula C20H28ClNO and a molecular weight of 333.90 g/mol. Its IUPAC name is (3R)-N-[(1R)-1-(4-chlorophenyl)ethyl]-3-(furan-2-yl)-6-methylheptan-1-amine.
| Compound Name | (3R)-N-[(1R)-1-(4-chlorophenyl)ethyl]-3-(furan-2-yl)-6-methylheptan-1-amine |
|---|---|
| PubChem CID | 7632387 |
| Molecular Formula | C20H28ClNO |
| Molecular Weight | 333.90 g/mol |
| Exact Mass | 333.19 |
| IUPAC Name | (3R)-N-[(1R)-1-(4-chlorophenyl)ethyl]-3-(furan-2-yl)-6-methylheptan-1-amine |
| SMILES | CC(C)CC[C@H](CCN[C@H](C)c1ccc(Cl)cc1)c1ccco1 |
| InChI | InChI=1S/C20H28ClNO/c1-15(2)6-7-18(20-5-4-14-23-20)12-13-22-16(3)17-8-10-19(21)11-9-17/h4-5,8-11,14-16,18,22H,6-7,12-13H2,1-3H3/t16-,18-/m1/s1 |
| InChIKey | NNSCSQWLZUNLPB-SJLPKXTDSA-N |
| XLogP | 6.19 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.90 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |