C14H14N2O4 — CID 76328970
N-ethyl-4-(hydroxyamino)-2-oxo-6-phenylpyran-3-carboxamide (PubChem CID 76328970) has the molecular formula C14H14N2O4 and a molecular weight of 274.27 g/mol. Its IUPAC name is N-ethyl-4-(hydroxyamino)-2-oxo-6-phenylpyran-3-carboxamide.
| Compound Name | N-ethyl-4-(hydroxyamino)-2-oxo-6-phenylpyran-3-carboxamide |
|---|---|
| PubChem CID | 76328970 |
| Molecular Formula | C14H14N2O4 |
| Molecular Weight | 274.27 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | N-ethyl-4-(hydroxyamino)-2-oxo-6-phenylpyran-3-carboxamide |
| SMILES | CCNC(=O)C1=C(C=C(OC1=O)C2=CC=CC=C2)NO |
| InChI | InChI=1S/C14H14N2O4/c1-2-15-13(17)12-10(16-19)8-11(20-14(12)18)9-6-4-3-5-7-9/h3-8,16,19H,2H2,1H3,(H,15,17) |
| InChIKey | YQOFDFRHVKUDNR-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 87.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | 462 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.27 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|