C24H33NO2 — CID 76329324
(2S)-3-[(2R,6S)-2,6-bis(2-phenylethyl)piperidin-1-yl]propane-1,2-diol (PubChem CID 76329324) has the molecular formula C24H33NO2 and a molecular weight of 367.50 g/mol. Its IUPAC name is (2S)-3-[(2R,6S)-2,6-bis(2-phenylethyl)piperidin-1-yl]propane-1,2-diol.
| Compound Name | (2S)-3-[(2R,6S)-2,6-bis(2-phenylethyl)piperidin-1-yl]propane-1,2-diol |
|---|---|
| PubChem CID | 76329324 |
| Molecular Formula | C24H33NO2 |
| Molecular Weight | 367.50 g/mol |
| Exact Mass | 367.25 |
| IUPAC Name | (2S)-3-[(2R,6S)-2,6-bis(2-phenylethyl)piperidin-1-yl]propane-1,2-diol |
| SMILES | C1C[C@@H](N([C@@H](C1)CCC2=CC=CC=C2)C[C@@H](CO)O)CCC3=CC=CC=C3 |
| InChI | InChI=1S/C24H33NO2/c26-19-24(27)18-25-22(16-14-20-8-3-1-4-9-20)12-7-13-23(25)17-15-21-10-5-2-6-11-21/h1-6,8-11,22-24,26-27H,7,12-19H2/t22-,23+,24-/m0/s1 |
| InChIKey | AUDMZPOFDFFVCB-VXNXHJTFSA-N |
| XLogP | 4.60 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | 360 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.50 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |