C23H30N5+ — CID 7633677
7-[4-(2-methylprop-2-enyl)piperazin-4-ium-1-yl]-3-phenyl-5-propan-2-ylpyrazolo[1,5-a]pyrimidine (PubChem CID 7633677) has the molecular formula C23H30N5+ and a molecular weight of 376.53 g/mol. Its IUPAC name is 7-[4-(2-methylprop-2-enyl)piperazin-4-ium-1-yl]-3-phenyl-5-propan-2-ylpyrazolo[1,5-a]pyrimidine.
| Compound Name | 7-[4-(2-methylprop-2-enyl)piperazin-4-ium-1-yl]-3-phenyl-5-propan-2-ylpyrazolo[1,5-a]pyrimidine |
|---|---|
| PubChem CID | 7633677 |
| Molecular Formula | C23H30N5+ |
| Molecular Weight | 376.53 g/mol |
| Exact Mass | 376.25 |
| IUPAC Name | 7-[4-(2-methylprop-2-enyl)piperazin-4-ium-1-yl]-3-phenyl-5-propan-2-ylpyrazolo[1,5-a]pyrimidine |
| SMILES | C=C(C)C[NH+]1CCN(c2cc(C(C)C)nc3c(-c4ccccc4)cnn23)CC1 |
| InChI | InChI=1S/C23H29N5/c1-17(2)16-26-10-12-27(13-11-26)22-14-21(18(3)4)25-23-20(15-24-28(22)23)19-8-6-5-7-9-19/h5-9,14-15,18H,1,10-13,16H2,2-4H3/p+1 |
| InChIKey | LBHNCCLRJIRXLX-UHFFFAOYSA-O |
| XLogP | 2.80 |
| TPSA | 37.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.53 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|