C16H20Cl3N3O3 — CID 7633783
[(2R)-1-[[(1S,2S)-2-methylcyclohexyl]amino]-1-oxopropan-2-yl] 4-amino-3,5,6-trichloropyridine-2-carboxylate (PubChem CID 7633783) has the molecular formula C16H20Cl3N3O3 and a molecular weight of 408.71 g/mol. Its IUPAC name is [(2R)-1-[[(1S,2S)-2-methylcyclohexyl]amino]-1-oxopropan-2-yl] 4-amino-3,5,6-trichloropyridine-2-carboxylate.
| Compound Name | [(2R)-1-[[(1S,2S)-2-methylcyclohexyl]amino]-1-oxopropan-2-yl] 4-amino-3,5,6-trichloropyridine-2-carboxylate |
|---|---|
| PubChem CID | 7633783 |
| Molecular Formula | C16H20Cl3N3O3 |
| Molecular Weight | 408.71 g/mol |
| Exact Mass | 407.06 |
| IUPAC Name | [(2R)-1-[[(1S,2S)-2-methylcyclohexyl]amino]-1-oxopropan-2-yl] 4-amino-3,5,6-trichloropyridine-2-carboxylate |
| SMILES | C[C@@H](OC(=O)c1nc(Cl)c(Cl)c(N)c1Cl)C(=O)N[C@H]1CCCC[C@@H]1C |
| InChI | InChI=1S/C16H20Cl3N3O3/c1-7-5-3-4-6-9(7)21-15(23)8(2)25-16(24)13-10(17)12(20)11(18)14(19)22-13/h7-9H,3-6H2,1-2H3,(H2,20,22)(H,21,23)/t7-,8+,9-/m0/s1 |
| InChIKey | HLGGKOSQUBXBEH-YIZRAAEISA-N |
| XLogP | 3.86 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.71 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|