C20H21NO7 — CID 7635121
[2-(1,3-benzodioxol-5-yl)-2-oxoethyl] 3-[(3aR,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]propanoate (PubChem CID 7635121) has the molecular formula C20H21NO7 and a molecular weight of 387.39 g/mol. Its IUPAC name is [2-(1,3-benzodioxol-5-yl)-2-oxoethyl] 3-[(3aR,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]propanoate.
| Compound Name | [2-(1,3-benzodioxol-5-yl)-2-oxoethyl] 3-[(3aR,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]propanoate |
|---|---|
| PubChem CID | 7635121 |
| Molecular Formula | C20H21NO7 |
| Molecular Weight | 387.39 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | [2-(1,3-benzodioxol-5-yl)-2-oxoethyl] 3-[(3aR,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]propanoate |
| SMILES | O=C(CCN1C(=O)[C@H]2CCCC[C@H]2C1=O)OCC(=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C20H21NO7/c22-15(12-5-6-16-17(9-12)28-11-27-16)10-26-18(23)7-8-21-19(24)13-3-1-2-4-14(13)20(21)25/h5-6,9,13-14H,1-4,7-8,10-11H2/t13-,14+ |
| InChIKey | SYVMHMOTPQDFRA-OKILXGFUSA-N |
| XLogP | 1.71 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.39 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|