About 2-thiophen-2-ylimidazo[2,1-a]isoquinoline
2-thiophen-2-ylimidazo[2,1-a]isoquinoline (PubChem CID 763549) has the molecular formula C15H10N2S
and a molecular weight of 250.33 g/mol. Its IUPAC name is 2-thiophen-2-ylimidazo[2,1-a]isoquinoline.
Molecular Properties
| Compound Name | 2-thiophen-2-ylimidazo[2,1-a]isoquinoline |
| PubChem CID | 763549 |
| Molecular Formula | C15H10N2S |
| Molecular Weight | 250.33 g/mol |
| Exact Mass | 250.06 |
| IUPAC Name | 2-thiophen-2-ylimidazo[2,1-a]isoquinoline |
| SMILES | c1csc(-c2cn3ccc4ccccc4c3n2)c1 |
| InChI | InChI=1S/C15H10N2S/c1-2-5-12-11(4-1)7-8-17-10-13(16-15(12)17)14-6-3-9-18-14/h1-10H |
| InChIKey | LYUNEGGFOJLIOK-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.33 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-thiophen-2-ylimidazo[2,1-a]isoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-thiophen-2-ylimidazo[2,1-a]isoquinoline?
The IUPAC name of 2-thiophen-2-ylimidazo[2,1-a]isoquinoline (CID 763549) is 2-thiophen-2-ylimidazo[2,1-a]isoquinoline.
What is the SMILES notation for 2-thiophen-2-ylimidazo[2,1-a]isoquinoline?
The canonical SMILES for 2-thiophen-2-ylimidazo[2,1-a]isoquinoline is c1csc(-c2cn3ccc4ccccc4c3n2)c1.
What is the InChIKey of 2-thiophen-2-ylimidazo[2,1-a]isoquinoline?
The InChIKey is LYUNEGGFOJLIOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10N2S/c1-2-5-12-11(4-1)7-8-17-10-13(16-15(12)17)14-6-3-9-18-14/h1-10H.
What are the key properties of 2-thiophen-2-ylimidazo[2,1-a]isoquinoline?
2-thiophen-2-ylimidazo[2,1-a]isoquinoline has a molecular weight of 250.33 g/mol, XLogP of 4.22, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-thiophen-2-ylimidazo[2,1-a]isoquinoline is sourced from PubChem (CID 763549), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).