About (2S,6R)-2,6-diphenylthian-4-one
(2S,6R)-2,6-diphenylthian-4-one (PubChem CID 763695) has the molecular formula C17H16OS
and a molecular weight of 268.38 g/mol. Its IUPAC name is (2S,6R)-2,6-diphenylthian-4-one.
Molecular Properties
| Compound Name | (2S,6R)-2,6-diphenylthian-4-one |
| PubChem CID | 763695 |
| Molecular Formula | C17H16OS |
| Molecular Weight | 268.38 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | (2S,6R)-2,6-diphenylthian-4-one |
| SMILES | O=C1C[C@@H](c2ccccc2)S[C@@H](c2ccccc2)C1 |
| InChI | InChI=1S/C17H16OS/c18-15-11-16(13-7-3-1-4-8-13)19-17(12-15)14-9-5-2-6-10-14/h1-10,16-17H,11-12H2/t16-,17+ |
| InChIKey | PPJHHCQGZVIWAR-CALCHBBNSA-N |
| XLogP | 4.57 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.38 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S,6R)-2,6-diphenylthian-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,6R)-2,6-diphenylthian-4-one?
The IUPAC name of (2S,6R)-2,6-diphenylthian-4-one (CID 763695) is (2S,6R)-2,6-diphenylthian-4-one.
What is the SMILES notation for (2S,6R)-2,6-diphenylthian-4-one?
The canonical SMILES for (2S,6R)-2,6-diphenylthian-4-one is O=C1C[C@@H](c2ccccc2)S[C@@H](c2ccccc2)C1.
What is the InChIKey of (2S,6R)-2,6-diphenylthian-4-one?
The InChIKey is PPJHHCQGZVIWAR-CALCHBBNSA-N. The full InChI is InChI=1S/C17H16OS/c18-15-11-16(13-7-3-1-4-8-13)19-17(12-15)14-9-5-2-6-10-14/h1-10,16-17H,11-12H2/t16-,17+.
What are the key properties of (2S,6R)-2,6-diphenylthian-4-one?
(2S,6R)-2,6-diphenylthian-4-one has a molecular weight of 268.38 g/mol, XLogP of 4.57, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,6R)-2,6-diphenylthian-4-one is sourced from PubChem (CID 763695), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).