C17H27N3O3 — CID 7639937
(5S,6R)-6-methyl-3-[(2S)-1-oxo-1-piperidin-1-ylpropan-2-yl]-1,3-diazaspiro[4.5]decane-2,4-dione (PubChem CID 7639937) has the molecular formula C17H27N3O3 and a molecular weight of 321.42 g/mol. Its IUPAC name is (5S,6R)-6-methyl-3-[(2S)-1-oxo-1-piperidin-1-ylpropan-2-yl]-1,3-diazaspiro[4.5]decane-2,4-dione.
| Compound Name | (5S,6R)-6-methyl-3-[(2S)-1-oxo-1-piperidin-1-ylpropan-2-yl]-1,3-diazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 7639937 |
| Molecular Formula | C17H27N3O3 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.21 |
| IUPAC Name | (5S,6R)-6-methyl-3-[(2S)-1-oxo-1-piperidin-1-ylpropan-2-yl]-1,3-diazaspiro[4.5]decane-2,4-dione |
| SMILES | C[C@@H]1CCCC[C@]12NC(=O)N([C@@H](C)C(=O)N1CCCCC1)C2=O |
| InChI | InChI=1S/C17H27N3O3/c1-12-8-4-5-9-17(12)15(22)20(16(23)18-17)13(2)14(21)19-10-6-3-7-11-19/h12-13H,3-11H2,1-2H3,(H,18,23)/t12-,13+,17+/m1/s1 |
| InChIKey | KKUAYTFSJAIWHY-IGCXYCKISA-N |
| XLogP | 1.89 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|