About 2-(2-acetyl-4,6-dichlorophenoxy)-N-[(2S)-4-phenylbutan-2-yl]acetamide
2-(2-acetyl-4,6-dichlorophenoxy)-N-[(2S)-4-phenylbutan-2-yl]acetamide (PubChem CID 7640030) has the molecular formula C20H21Cl2NO3
and a molecular weight of 394.30 g/mol. Its IUPAC name is 2-(2-acetyl-4,6-dichlorophenoxy)-N-[(2S)-4-phenylbutan-2-yl]acetamide.
Molecular Properties
| Compound Name | 2-(2-acetyl-4,6-dichlorophenoxy)-N-[(2S)-4-phenylbutan-2-yl]acetamide |
| PubChem CID | 7640030 |
| Molecular Formula | C20H21Cl2NO3 |
| Molecular Weight | 394.30 g/mol |
| Exact Mass | 393.09 |
| IUPAC Name | 2-(2-acetyl-4,6-dichlorophenoxy)-N-[(2S)-4-phenylbutan-2-yl]acetamide |
| SMILES | CC(=O)c1cc(Cl)cc(Cl)c1OCC(=O)N[C@@H](C)CCc1ccccc1 |
| InChI | InChI=1S/C20H21Cl2NO3/c1-13(8-9-15-6-4-3-5-7-15)23-19(25)12-26-20-17(14(2)24)10-16(21)11-18(20)22/h3-7,10-11,13H,8-9,12H2,1-2H3,(H,23,25)/t13-/m0/s1 |
| InChIKey | ADCYNBWDCNXCEX-ZDUSSCGKSA-N |
| XLogP | 4.71 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.30 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(2-acetyl-4,6-dichlorophenoxy)-N-[(2S)-4-phenylbutan-2-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-acetyl-4,6-dichlorophenoxy)-N-[(2S)-4-phenylbutan-2-yl]acetamide?
The IUPAC name of 2-(2-acetyl-4,6-dichlorophenoxy)-N-[(2S)-4-phenylbutan-2-yl]acetamide (CID 7640030) is 2-(2-acetyl-4,6-dichlorophenoxy)-N-[(2S)-4-phenylbutan-2-yl]acetamide.
What is the SMILES notation for 2-(2-acetyl-4,6-dichlorophenoxy)-N-[(2S)-4-phenylbutan-2-yl]acetamide?
The canonical SMILES for 2-(2-acetyl-4,6-dichlorophenoxy)-N-[(2S)-4-phenylbutan-2-yl]acetamide is CC(=O)c1cc(Cl)cc(Cl)c1OCC(=O)N[C@@H](C)CCc1ccccc1.
What is the InChIKey of 2-(2-acetyl-4,6-dichlorophenoxy)-N-[(2S)-4-phenylbutan-2-yl]acetamide?
The InChIKey is ADCYNBWDCNXCEX-ZDUSSCGKSA-N. The full InChI is InChI=1S/C20H21Cl2NO3/c1-13(8-9-15-6-4-3-5-7-15)23-19(25)12-26-20-17(14(2)24)10-16(21)11-18(20)22/h3-7,10-11,13H,8-9,12H2,1-2H3,(H,23,25)/t13-/m0/s1.
What are the key properties of 2-(2-acetyl-4,6-dichlorophenoxy)-N-[(2S)-4-phenylbutan-2-yl]acetamide?
2-(2-acetyl-4,6-dichlorophenoxy)-N-[(2S)-4-phenylbutan-2-yl]acetamide has a molecular weight of 394.30 g/mol, XLogP of 4.71, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-acetyl-4,6-dichlorophenoxy)-N-[(2S)-4-phenylbutan-2-yl]acetamide is sourced from PubChem (CID 7640030), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).