About 6-chloro-1,3-dimethyl-5-nitroimidazo[4,5-b]pyridin-2-one
6-chloro-1,3-dimethyl-5-nitroimidazo[4,5-b]pyridin-2-one (PubChem CID 764067) has the molecular formula C8H7ClN4O3
and a molecular weight of 242.62 g/mol. Its IUPAC name is 6-chloro-1,3-dimethyl-5-nitroimidazo[4,5-b]pyridin-2-one.
Molecular Properties
| Compound Name | 6-chloro-1,3-dimethyl-5-nitroimidazo[4,5-b]pyridin-2-one |
| PubChem CID | 764067 |
| Molecular Formula | C8H7ClN4O3 |
| Molecular Weight | 242.62 g/mol |
| Exact Mass | 242.02 |
| IUPAC Name | 6-chloro-1,3-dimethyl-5-nitroimidazo[4,5-b]pyridin-2-one |
| SMILES | Cn1c(=O)n(C)c2nc([N+](=O)[O-])c(Cl)cc21 |
| InChI | InChI=1S/C8H7ClN4O3/c1-11-5-3-4(9)6(13(15)16)10-7(5)12(2)8(11)14/h3H,1-2H3 |
| InChIKey | GEDXIBYRXOWQEW-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 82.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.62 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-chloro-1,3-dimethyl-5-nitroimidazo[4,5-b]pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-1,3-dimethyl-5-nitroimidazo[4,5-b]pyridin-2-one?
The IUPAC name of 6-chloro-1,3-dimethyl-5-nitroimidazo[4,5-b]pyridin-2-one (CID 764067) is 6-chloro-1,3-dimethyl-5-nitroimidazo[4,5-b]pyridin-2-one.
What is the SMILES notation for 6-chloro-1,3-dimethyl-5-nitroimidazo[4,5-b]pyridin-2-one?
The canonical SMILES for 6-chloro-1,3-dimethyl-5-nitroimidazo[4,5-b]pyridin-2-one is Cn1c(=O)n(C)c2nc([N+](=O)[O-])c(Cl)cc21.
What is the InChIKey of 6-chloro-1,3-dimethyl-5-nitroimidazo[4,5-b]pyridin-2-one?
The InChIKey is GEDXIBYRXOWQEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7ClN4O3/c1-11-5-3-4(9)6(13(15)16)10-7(5)12(2)8(11)14/h3H,1-2H3.
What are the key properties of 6-chloro-1,3-dimethyl-5-nitroimidazo[4,5-b]pyridin-2-one?
6-chloro-1,3-dimethyl-5-nitroimidazo[4,5-b]pyridin-2-one has a molecular weight of 242.62 g/mol, XLogP of 0.83, 1 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-1,3-dimethyl-5-nitroimidazo[4,5-b]pyridin-2-one is sourced from PubChem (CID 764067), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).