C12H15F3N2O2 — CID 76408551
N-[2-({bicyclo[2.2.1]hept-5-en-2-yl}formamido)ethyl]-2,2,2-trifluoroacetamide (PubChem CID 76408551) has the molecular formula C12H15F3N2O2 and a molecular weight of 276.25 g/mol. Its IUPAC name is N-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]bicyclo[2.2.1]hept-5-ene-2-carboxamide.
| Compound Name | N-[2-({bicyclo[2.2.1]hept-5-en-2-yl}formamido)ethyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 76408551 |
| Molecular Formula | C12H15F3N2O2 |
| Molecular Weight | 276.25 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | N-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]bicyclo[2.2.1]hept-5-ene-2-carboxamide |
| SMILES | C1C2CC(C1C=C2)C(=O)NCCNC(=O)C(F)(F)F |
| InChI | InChI=1S/C12H15F3N2O2/c13-12(14,15)11(19)17-4-3-16-10(18)9-6-7-1-2-8(9)5-7/h1-2,7-9H,3-6H2,(H,16,18)(H,17,19) |
| InChIKey | GDCFAKHIIGVLEI-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | 406 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.25 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|