C19H25N4O3+ — CID 7640873
5-[[2-(4-ethylpiperazin-4-ium-1-yl)phenyl]methylidene]-1,3-dimethyl-1,3-diazinane-2,4,6-trione (PubChem CID 7640873) has the molecular formula C19H25N4O3+ and a molecular weight of 357.43 g/mol. Its IUPAC name is 5-[[2-(4-ethylpiperazin-4-ium-1-yl)phenyl]methylidene]-1,3-dimethyl-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[[2-(4-ethylpiperazin-4-ium-1-yl)phenyl]methylidene]-1,3-dimethyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 7640873 |
| Molecular Formula | C19H25N4O3+ |
| Molecular Weight | 357.43 g/mol |
| Exact Mass | 357.19 |
| IUPAC Name | 5-[[2-(4-ethylpiperazin-4-ium-1-yl)phenyl]methylidene]-1,3-dimethyl-1,3-diazinane-2,4,6-trione |
| SMILES | CC[NH+]1CCN(c2ccccc2C=C2C(=O)N(C)C(=O)N(C)C2=O)CC1 |
| InChI | InChI=1S/C19H24N4O3/c1-4-22-9-11-23(12-10-22)16-8-6-5-7-14(16)13-15-17(24)20(2)19(26)21(3)18(15)25/h5-8,13H,4,9-12H2,1-3H3/p+1 |
| InChIKey | PUYGPQKYRHBLEI-UHFFFAOYSA-O |
| XLogP | -0.15 |
| TPSA | 65.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.43 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|