C20H25ClN3O4+ — CID 7640965
(1R,3R,3aR,6aS)-5-[(2S)-butan-2-yl]-5'-chloro-1-[(1R)-1-hydroxyethyl]-7'-methylspiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrol-2-ium-3,3'-1H-indole]-2',4,6-trione (PubChem CID 7640965) has the molecular formula C20H25ClN3O4+ and a molecular weight of 406.89 g/mol. Its IUPAC name is (1R,3R,3aR,6aS)-5-[(2S)-butan-2-yl]-5'-chloro-1-[(1R)-1-hydroxyethyl]-7'-methylspiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrol-2-ium-3,3'-1H-indole]-2',4,6-trione.
| Compound Name | (1R,3R,3aR,6aS)-5-[(2S)-butan-2-yl]-5'-chloro-1-[(1R)-1-hydroxyethyl]-7'-methylspiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrol-2-ium-3,3'-1H-indole]-2',4,6-trione |
|---|---|
| PubChem CID | 7640965 |
| Molecular Formula | C20H25ClN3O4+ |
| Molecular Weight | 406.89 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | (1R,3R,3aR,6aS)-5-[(2S)-butan-2-yl]-5'-chloro-1-[(1R)-1-hydroxyethyl]-7'-methylspiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrol-2-ium-3,3'-1H-indole]-2',4,6-trione |
| SMILES | CC[C@H](C)N1C(=O)[C@@H]2[C@H]([C@@H](C)O)[NH2+][C@]3(C(=O)Nc4c(C)cc(Cl)cc43)[C@@H]2C1=O |
| InChI | InChI=1S/C20H24ClN3O4/c1-5-9(3)24-17(26)13-14(18(24)27)20(23-16(13)10(4)25)12-7-11(21)6-8(2)15(12)22-19(20)28/h6-7,9-10,13-14,16,23,25H,5H2,1-4H3,(H,22,28)/p+1/t9-,10+,13-,14-,16-,20-/m0/s1 |
| InChIKey | KYBSGTWCHDEYMC-PLCXRCKASA-O |
| XLogP | 0.52 |
| TPSA | 103.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.89 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|