C23H23N4O2+ — CID 7641869
(11S)-14-[2-(dimethylamino)ethyl]-11-(furan-2-yl)-18-oxa-16-aza-14-azoniatetracyclo[8.8.0.02,7.012,17]octadeca-1(10),2,4,6,8,12(17),13,15-octaen-13-amine (PubChem CID 7641869) has the molecular formula C23H23N4O2+ and a molecular weight of 387.46 g/mol. Its IUPAC name is (11S)-14-[2-(dimethylamino)ethyl]-11-(furan-2-yl)-18-oxa-16-aza-14-azoniatetracyclo[8.8.0.02,7.012,17]octadeca-1(10),2,4,6,8,12(17),13,15-octaen-13-amine.
| Compound Name | (11S)-14-[2-(dimethylamino)ethyl]-11-(furan-2-yl)-18-oxa-16-aza-14-azoniatetracyclo[8.8.0.02,7.012,17]octadeca-1(10),2,4,6,8,12(17),13,15-octaen-13-amine |
|---|---|
| PubChem CID | 7641869 |
| Molecular Formula | C23H23N4O2+ |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | (11S)-14-[2-(dimethylamino)ethyl]-11-(furan-2-yl)-18-oxa-16-aza-14-azoniatetracyclo[8.8.0.02,7.012,17]octadeca-1(10),2,4,6,8,12(17),13,15-octaen-13-amine |
| SMILES | CN(C)CC[n+]1cnc2c(c1N)[C@@H](c1ccco1)c1ccc3ccccc3c1O2 |
| InChI | InChI=1S/C23H22N4O2/c1-26(2)11-12-27-14-25-23-20(22(27)24)19(18-8-5-13-28-18)17-10-9-15-6-3-4-7-16(15)21(17)29-23/h3-10,13-14,19,24H,11-12H2,1-2H3/p+1/t19-/m1/s1 |
| InChIKey | ZODKOYHXOVKKBR-LJQANCHMSA-O |
| XLogP | 3.55 |
| TPSA | 68.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|