C17H14Cl2N5S+ — CID 7641894
4-(2,4-dichlorophenyl)-13-methyl-10-thia-3,5,6,8-tetraza-13-azoniatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaene (PubChem CID 7641894) has the molecular formula C17H14Cl2N5S+ and a molecular weight of 391.31 g/mol. Its IUPAC name is 4-(2,4-dichlorophenyl)-13-methyl-10-thia-3,5,6,8-tetraza-13-azoniatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaene.
| Compound Name | 4-(2,4-dichlorophenyl)-13-methyl-10-thia-3,5,6,8-tetraza-13-azoniatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaene |
|---|---|
| PubChem CID | 7641894 |
| Molecular Formula | C17H14Cl2N5S+ |
| Molecular Weight | 391.31 g/mol |
| Exact Mass | 390.03 |
| IUPAC Name | 4-(2,4-dichlorophenyl)-13-methyl-10-thia-3,5,6,8-tetraza-13-azoniatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaene |
| SMILES | C[NH+]1CCc2c(sc3ncn4nc(-c5ccc(Cl)cc5Cl)nc4c23)C1 |
| InChI | InChI=1S/C17H13Cl2N5S/c1-23-5-4-11-13(7-23)25-17-14(11)16-21-15(22-24(16)8-20-17)10-3-2-9(18)6-12(10)19/h2-3,6,8H,4-5,7H2,1H3/p+1 |
| InChIKey | HHTFLSPRFXZGTH-UHFFFAOYSA-O |
| XLogP | 2.88 |
| TPSA | 47.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.31 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |