About 6-hydroxy-1-[(1R)-1-phenylethyl]pyrimidine-2,4-dione
6-hydroxy-1-[(1R)-1-phenylethyl]pyrimidine-2,4-dione (PubChem CID 7642095) has the molecular formula C12H12N2O3
and a molecular weight of 232.24 g/mol. Its IUPAC name is 6-hydroxy-1-[(1R)-1-phenylethyl]pyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 6-hydroxy-1-[(1R)-1-phenylethyl]pyrimidine-2,4-dione |
| PubChem CID | 7642095 |
| Molecular Formula | C12H12N2O3 |
| Molecular Weight | 232.24 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | 6-hydroxy-1-[(1R)-1-phenylethyl]pyrimidine-2,4-dione |
| SMILES | C[C@H](c1ccccc1)n1c(O)cc(=O)[nH]c1=O |
| InChI | InChI=1S/C12H12N2O3/c1-8(9-5-3-2-4-6-9)14-11(16)7-10(15)13-12(14)17/h2-8,16H,1H3,(H,13,15,17)/t8-/m1/s1 |
| InChIKey | QBVZEQCXHDDMIC-MRVPVSSYSA-N |
| XLogP | 0.85 |
| TPSA | 75.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.24 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-hydroxy-1-[(1R)-1-phenylethyl]pyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-hydroxy-1-[(1R)-1-phenylethyl]pyrimidine-2,4-dione?
The IUPAC name of 6-hydroxy-1-[(1R)-1-phenylethyl]pyrimidine-2,4-dione (CID 7642095) is 6-hydroxy-1-[(1R)-1-phenylethyl]pyrimidine-2,4-dione.
What is the SMILES notation for 6-hydroxy-1-[(1R)-1-phenylethyl]pyrimidine-2,4-dione?
The canonical SMILES for 6-hydroxy-1-[(1R)-1-phenylethyl]pyrimidine-2,4-dione is C[C@H](c1ccccc1)n1c(O)cc(=O)[nH]c1=O.
What is the InChIKey of 6-hydroxy-1-[(1R)-1-phenylethyl]pyrimidine-2,4-dione?
The InChIKey is QBVZEQCXHDDMIC-MRVPVSSYSA-N. The full InChI is InChI=1S/C12H12N2O3/c1-8(9-5-3-2-4-6-9)14-11(16)7-10(15)13-12(14)17/h2-8,16H,1H3,(H,13,15,17)/t8-/m1/s1.
What are the key properties of 6-hydroxy-1-[(1R)-1-phenylethyl]pyrimidine-2,4-dione?
6-hydroxy-1-[(1R)-1-phenylethyl]pyrimidine-2,4-dione has a molecular weight of 232.24 g/mol, XLogP of 0.85, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-hydroxy-1-[(1R)-1-phenylethyl]pyrimidine-2,4-dione is sourced from PubChem (CID 7642095), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).