About 6-(4-bromophenyl)-2,3-dihydroimidazo[2,1-b][1,3]thiazole
6-(4-bromophenyl)-2,3-dihydroimidazo[2,1-b][1,3]thiazole (PubChem CID 764271) has the molecular formula C11H9BrN2S
and a molecular weight of 281.18 g/mol. Its IUPAC name is 6-(4-bromophenyl)-2,3-dihydroimidazo[2,1-b][1,3]thiazole.
Molecular Properties
| Compound Name | 6-(4-bromophenyl)-2,3-dihydroimidazo[2,1-b][1,3]thiazole |
| PubChem CID | 764271 |
| Molecular Formula | C11H9BrN2S |
| Molecular Weight | 281.18 g/mol |
| Exact Mass | 279.97 |
| IUPAC Name | 6-(4-bromophenyl)-2,3-dihydroimidazo[2,1-b][1,3]thiazole |
| SMILES | Brc1ccc(-c2cn3c(n2)SCC3)cc1 |
| InChI | InChI=1S/C11H9BrN2S/c12-9-3-1-8(2-4-9)10-7-14-5-6-15-11(14)13-10/h1-4,7H,5-6H2 |
| InChIKey | GPJBSEDJRPMPHS-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.18 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-(4-bromophenyl)-2,3-dihydroimidazo[2,1-b][1,3]thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(4-bromophenyl)-2,3-dihydroimidazo[2,1-b][1,3]thiazole?
The IUPAC name of 6-(4-bromophenyl)-2,3-dihydroimidazo[2,1-b][1,3]thiazole (CID 764271) is 6-(4-bromophenyl)-2,3-dihydroimidazo[2,1-b][1,3]thiazole.
What is the SMILES notation for 6-(4-bromophenyl)-2,3-dihydroimidazo[2,1-b][1,3]thiazole?
The canonical SMILES for 6-(4-bromophenyl)-2,3-dihydroimidazo[2,1-b][1,3]thiazole is Brc1ccc(-c2cn3c(n2)SCC3)cc1.
What is the InChIKey of 6-(4-bromophenyl)-2,3-dihydroimidazo[2,1-b][1,3]thiazole?
The InChIKey is GPJBSEDJRPMPHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9BrN2S/c12-9-3-1-8(2-4-9)10-7-14-5-6-15-11(14)13-10/h1-4,7H,5-6H2.
What are the key properties of 6-(4-bromophenyl)-2,3-dihydroimidazo[2,1-b][1,3]thiazole?
6-(4-bromophenyl)-2,3-dihydroimidazo[2,1-b][1,3]thiazole has a molecular weight of 281.18 g/mol, XLogP of 3.42, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(4-bromophenyl)-2,3-dihydroimidazo[2,1-b][1,3]thiazole is sourced from PubChem (CID 764271), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).