C15H20N2O3 — CID 7642995
2-(2,3-dihydro-1H-inden-5-yloxy)-N-(propylcarbamoyl)acetamide (PubChem CID 7642995) has the molecular formula C15H20N2O3 and a molecular weight of 276.34 g/mol. Its IUPAC name is 2-(2,3-dihydro-1H-inden-5-yloxy)-N-(propylcarbamoyl)acetamide.
| Compound Name | 2-(2,3-dihydro-1H-inden-5-yloxy)-N-(propylcarbamoyl)acetamide |
|---|---|
| PubChem CID | 7642995 |
| Molecular Formula | C15H20N2O3 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | 2-(2,3-dihydro-1H-inden-5-yloxy)-N-(propylcarbamoyl)acetamide |
| SMILES | CCCNC(=O)NC(=O)COc1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C15H20N2O3/c1-2-8-16-15(19)17-14(18)10-20-13-7-6-11-4-3-5-12(11)9-13/h6-7,9H,2-5,8,10H2,1H3,(H2,16,17,18,19) |
| InChIKey | SQVZOTJETARELF-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |