About 3-[[(3R)-3-[(4S)-2,2-dimethyloxan-4-yl]-3-phenylpropyl]azaniumyl]propyl-diethylazanium
3-[[(3R)-3-[(4S)-2,2-dimethyloxan-4-yl]-3-phenylpropyl]azaniumyl]propyl-diethylazanium (PubChem CID 7643138) has the molecular formula C23H42N2O+2
and a molecular weight of 362.60 g/mol. Its IUPAC name is 3-[[(3R)-3-[(4S)-2,2-dimethyloxan-4-yl]-3-phenylpropyl]azaniumyl]propyl-diethylazanium.
Molecular Properties
| Compound Name | 3-[[(3R)-3-[(4S)-2,2-dimethyloxan-4-yl]-3-phenylpropyl]azaniumyl]propyl-diethylazanium |
| PubChem CID | 7643138 |
| Molecular Formula | C23H42N2O+2 |
| Molecular Weight | 362.60 g/mol |
| Exact Mass | 362.33 |
| IUPAC Name | 3-[[(3R)-3-[(4S)-2,2-dimethyloxan-4-yl]-3-phenylpropyl]azaniumyl]propyl-diethylazanium |
| SMILES | CC[NH+](CC)CCC[NH2+]CC[C@@H](c1ccccc1)[C@H]1CCOC(C)(C)C1 |
| InChI | InChI=1S/C23H40N2O/c1-5-25(6-2)17-10-15-24-16-13-22(20-11-8-7-9-12-20)21-14-18-26-23(3,4)19-21/h7-9,11-12,21-22,24H,5-6,10,13-19H2,1-4H3/p+2/t21-,22-/m0/s1 |
| InChIKey | UICZBDAMKPGYLB-VXKWHMMOSA-P |
| XLogP | 2.24 |
| TPSA | 30.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.60 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[[(3R)-3-[(4S)-2,2-dimethyloxan-4-yl]-3-phenylpropyl]azaniumyl]propyl-diethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[(3R)-3-[(4S)-2,2-dimethyloxan-4-yl]-3-phenylpropyl]azaniumyl]propyl-diethylazanium?
The IUPAC name of 3-[[(3R)-3-[(4S)-2,2-dimethyloxan-4-yl]-3-phenylpropyl]azaniumyl]propyl-diethylazanium (CID 7643138) is 3-[[(3R)-3-[(4S)-2,2-dimethyloxan-4-yl]-3-phenylpropyl]azaniumyl]propyl-diethylazanium.
What is the SMILES notation for 3-[[(3R)-3-[(4S)-2,2-dimethyloxan-4-yl]-3-phenylpropyl]azaniumyl]propyl-diethylazanium?
The canonical SMILES for 3-[[(3R)-3-[(4S)-2,2-dimethyloxan-4-yl]-3-phenylpropyl]azaniumyl]propyl-diethylazanium is CC[NH+](CC)CCC[NH2+]CC[C@@H](c1ccccc1)[C@H]1CCOC(C)(C)C1.
What is the InChIKey of 3-[[(3R)-3-[(4S)-2,2-dimethyloxan-4-yl]-3-phenylpropyl]azaniumyl]propyl-diethylazanium?
The InChIKey is UICZBDAMKPGYLB-VXKWHMMOSA-P. The full InChI is InChI=1S/C23H40N2O/c1-5-25(6-2)17-10-15-24-16-13-22(20-11-8-7-9-12-20)21-14-18-26-23(3,4)19-21/h7-9,11-12,21-22,24H,5-6,10,13-19H2,1-4H3/p+2/t21-,22-/m0/s1.
What are the key properties of 3-[[(3R)-3-[(4S)-2,2-dimethyloxan-4-yl]-3-phenylpropyl]azaniumyl]propyl-diethylazanium?
3-[[(3R)-3-[(4S)-2,2-dimethyloxan-4-yl]-3-phenylpropyl]azaniumyl]propyl-diethylazanium has a molecular weight of 362.60 g/mol, XLogP of 2.24, 11 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[(3R)-3-[(4S)-2,2-dimethyloxan-4-yl]-3-phenylpropyl]azaniumyl]propyl-diethylazanium is sourced from PubChem (CID 7643138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).