C22H37N5O3 — CID 7644835
N-[2-(diethylamino)ethyl]-N'-[(2S)-2-[4-(dimethylamino)phenyl]-2-morpholin-4-ylethyl]oxamide (PubChem CID 7644835) has the molecular formula C22H37N5O3 and a molecular weight of 419.57 g/mol. Its IUPAC name is N-[2-(diethylamino)ethyl]-N'-[(2S)-2-[4-(dimethylamino)phenyl]-2-morpholin-4-ylethyl]oxamide.
| Compound Name | N-[2-(diethylamino)ethyl]-N'-[(2S)-2-[4-(dimethylamino)phenyl]-2-morpholin-4-ylethyl]oxamide |
|---|---|
| PubChem CID | 7644835 |
| Molecular Formula | C22H37N5O3 |
| Molecular Weight | 419.57 g/mol |
| Exact Mass | 419.29 |
| IUPAC Name | N-[2-(diethylamino)ethyl]-N'-[(2S)-2-[4-(dimethylamino)phenyl]-2-morpholin-4-ylethyl]oxamide |
| SMILES | CCN(CC)CCNC(=O)C(=O)NC[C@H](c1ccc(N(C)C)cc1)N1CCOCC1 |
| InChI | InChI=1S/C22H37N5O3/c1-5-26(6-2)12-11-23-21(28)22(29)24-17-20(27-13-15-30-16-14-27)18-7-9-19(10-8-18)25(3)4/h7-10,20H,5-6,11-17H2,1-4H3,(H,23,28)(H,24,29)/t20-/m1/s1 |
| InChIKey | MSEJTCHAUOFZOB-HXUWFJFHSA-N |
| XLogP | 0.70 |
| TPSA | 77.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.57 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|