About 1-(4-fluorophenyl)-3,5-dimethyl-4-(3-nitrophenyl)pyrazole
1-(4-fluorophenyl)-3,5-dimethyl-4-(3-nitrophenyl)pyrazole (PubChem CID 764514) has the molecular formula C17H14FN3O2
and a molecular weight of 311.32 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-3,5-dimethyl-4-(3-nitrophenyl)pyrazole.
Molecular Properties
| Compound Name | 1-(4-fluorophenyl)-3,5-dimethyl-4-(3-nitrophenyl)pyrazole |
| PubChem CID | 764514 |
| Molecular Formula | C17H14FN3O2 |
| Molecular Weight | 311.32 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | 1-(4-fluorophenyl)-3,5-dimethyl-4-(3-nitrophenyl)pyrazole |
| SMILES | Cc1nn(-c2ccc(F)cc2)c(C)c1-c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H14FN3O2/c1-11-17(13-4-3-5-16(10-13)21(22)23)12(2)20(19-11)15-8-6-14(18)7-9-15/h3-10H,1-2H3 |
| InChIKey | RQFQVOZIOOECDN-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 60.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.32 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-fluorophenyl)-3,5-dimethyl-4-(3-nitrophenyl)pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-fluorophenyl)-3,5-dimethyl-4-(3-nitrophenyl)pyrazole?
The IUPAC name of 1-(4-fluorophenyl)-3,5-dimethyl-4-(3-nitrophenyl)pyrazole (CID 764514) is 1-(4-fluorophenyl)-3,5-dimethyl-4-(3-nitrophenyl)pyrazole.
What is the SMILES notation for 1-(4-fluorophenyl)-3,5-dimethyl-4-(3-nitrophenyl)pyrazole?
The canonical SMILES for 1-(4-fluorophenyl)-3,5-dimethyl-4-(3-nitrophenyl)pyrazole is Cc1nn(-c2ccc(F)cc2)c(C)c1-c1cccc([N+](=O)[O-])c1.
What is the InChIKey of 1-(4-fluorophenyl)-3,5-dimethyl-4-(3-nitrophenyl)pyrazole?
The InChIKey is RQFQVOZIOOECDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14FN3O2/c1-11-17(13-4-3-5-16(10-13)21(22)23)12(2)20(19-11)15-8-6-14(18)7-9-15/h3-10H,1-2H3.
What are the key properties of 1-(4-fluorophenyl)-3,5-dimethyl-4-(3-nitrophenyl)pyrazole?
1-(4-fluorophenyl)-3,5-dimethyl-4-(3-nitrophenyl)pyrazole has a molecular weight of 311.32 g/mol, XLogP of 4.20, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-fluorophenyl)-3,5-dimethyl-4-(3-nitrophenyl)pyrazole is sourced from PubChem (CID 764514), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).