About N'-(1H-1,2,4-triazole-5-carbonyl)pyridine-4-carbohydrazide
N'-(1H-1,2,4-triazole-5-carbonyl)pyridine-4-carbohydrazide (PubChem CID 764523) has the molecular formula C9H8N6O2
and a molecular weight of 232.20 g/mol. Its IUPAC name is N'-(1H-1,2,4-triazole-5-carbonyl)pyridine-4-carbohydrazide.
Molecular Properties
| Compound Name | N'-(1H-1,2,4-triazole-5-carbonyl)pyridine-4-carbohydrazide |
| PubChem CID | 764523 |
| Molecular Formula | C9H8N6O2 |
| Molecular Weight | 232.20 g/mol |
| Exact Mass | 232.07 |
| IUPAC Name | N'-(1H-1,2,4-triazole-5-carbonyl)pyridine-4-carbohydrazide |
| SMILES | O=C(NNC(=O)c1ncn[nH]1)c1ccncc1 |
| InChI | InChI=1S/C9H8N6O2/c16-8(6-1-3-10-4-2-6)14-15-9(17)7-11-5-12-13-7/h1-5H,(H,14,16)(H,15,17)(H,11,12,13) |
| InChIKey | RROBWFUTDWFUII-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 112.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.20 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-(1H-1,2,4-triazole-5-carbonyl)pyridine-4-carbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(1H-1,2,4-triazole-5-carbonyl)pyridine-4-carbohydrazide?
The IUPAC name of N'-(1H-1,2,4-triazole-5-carbonyl)pyridine-4-carbohydrazide (CID 764523) is N'-(1H-1,2,4-triazole-5-carbonyl)pyridine-4-carbohydrazide.
What is the SMILES notation for N'-(1H-1,2,4-triazole-5-carbonyl)pyridine-4-carbohydrazide?
The canonical SMILES for N'-(1H-1,2,4-triazole-5-carbonyl)pyridine-4-carbohydrazide is O=C(NNC(=O)c1ncn[nH]1)c1ccncc1.
What is the InChIKey of N'-(1H-1,2,4-triazole-5-carbonyl)pyridine-4-carbohydrazide?
The InChIKey is RROBWFUTDWFUII-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N6O2/c16-8(6-1-3-10-4-2-6)14-15-9(17)7-11-5-12-13-7/h1-5H,(H,14,16)(H,15,17)(H,11,12,13).
What are the key properties of N'-(1H-1,2,4-triazole-5-carbonyl)pyridine-4-carbohydrazide?
N'-(1H-1,2,4-triazole-5-carbonyl)pyridine-4-carbohydrazide has a molecular weight of 232.20 g/mol, XLogP of -0.73, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(1H-1,2,4-triazole-5-carbonyl)pyridine-4-carbohydrazide is sourced from PubChem (CID 764523), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).