About N'-cyclopropyl-N-[[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]methyl]oxamide
N'-cyclopropyl-N-[[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]methyl]oxamide (PubChem CID 7646222) has the molecular formula C14H22N2O4
and a molecular weight of 282.34 g/mol. Its IUPAC name is N'-cyclopropyl-N-[[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]methyl]oxamide.
Molecular Properties
| Compound Name | N'-cyclopropyl-N-[[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]methyl]oxamide |
| PubChem CID | 7646222 |
| Molecular Formula | C14H22N2O4 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | N'-cyclopropyl-N-[[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]methyl]oxamide |
| SMILES | O=C(NC[C@@H]1COC2(CCCCC2)O1)C(=O)NC1CC1 |
| InChI | InChI=1S/C14H22N2O4/c17-12(13(18)16-10-4-5-10)15-8-11-9-19-14(20-11)6-2-1-3-7-14/h10-11H,1-9H2,(H,15,17)(H,16,18)/t11-/m1/s1 |
| InChIKey | ODCLOSAMRXCJMZ-LLVKDONJSA-N |
| XLogP | 0.46 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N'-cyclopropyl-N-[[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]methyl]oxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-cyclopropyl-N-[[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]methyl]oxamide?
The IUPAC name of N'-cyclopropyl-N-[[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]methyl]oxamide (CID 7646222) is N'-cyclopropyl-N-[[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]methyl]oxamide.
What is the SMILES notation for N'-cyclopropyl-N-[[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]methyl]oxamide?
The canonical SMILES for N'-cyclopropyl-N-[[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]methyl]oxamide is O=C(NC[C@@H]1COC2(CCCCC2)O1)C(=O)NC1CC1.
What is the InChIKey of N'-cyclopropyl-N-[[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]methyl]oxamide?
The InChIKey is ODCLOSAMRXCJMZ-LLVKDONJSA-N. The full InChI is InChI=1S/C14H22N2O4/c17-12(13(18)16-10-4-5-10)15-8-11-9-19-14(20-11)6-2-1-3-7-14/h10-11H,1-9H2,(H,15,17)(H,16,18)/t11-/m1/s1.
What are the key properties of N'-cyclopropyl-N-[[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]methyl]oxamide?
N'-cyclopropyl-N-[[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]methyl]oxamide has a molecular weight of 282.34 g/mol, XLogP of 0.46, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-cyclopropyl-N-[[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]methyl]oxamide is sourced from PubChem (CID 7646222), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).