C14H22N2O4 — CID 7646222
N'-cyclopropyl-N-[[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]methyl]oxamide (PubChem CID 7646222) has the molecular formula C14H22N2O4 and a molecular weight of 282.34 g/mol. Its IUPAC name is N'-cyclopropyl-N-[[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]methyl]oxamide.
| Compound Name | N'-cyclopropyl-N-[[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]methyl]oxamide |
|---|---|
| PubChem CID | 7646222 |
| Molecular Formula | C14H22N2O4 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | N'-cyclopropyl-N-[[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]methyl]oxamide |
| SMILES | O=C(NC[C@@H]1COC2(CCCCC2)O1)C(=O)NC1CC1 |
| InChI | InChI=1S/C14H22N2O4/c17-12(13(18)16-10-4-5-10)15-8-11-9-19-14(20-11)6-2-1-3-7-14/h10-11H,1-9H2,(H,15,17)(H,16,18)/t11-/m1/s1 |
| InChIKey | ODCLOSAMRXCJMZ-LLVKDONJSA-N |
| XLogP | 0.46 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|