About N-[[(3R)-1,4-dioxaspiro[4.4]nonan-3-yl]methyl]-N'-[(4-fluorophenyl)methyl]oxamide
N-[[(3R)-1,4-dioxaspiro[4.4]nonan-3-yl]methyl]-N'-[(4-fluorophenyl)methyl]oxamide (PubChem CID 7646586) has the molecular formula C17H21FN2O4
and a molecular weight of 336.36 g/mol. Its IUPAC name is N-[[(3R)-1,4-dioxaspiro[4.4]nonan-3-yl]methyl]-N'-[(4-fluorophenyl)methyl]oxamide.
Molecular Properties
| Compound Name | N-[[(3R)-1,4-dioxaspiro[4.4]nonan-3-yl]methyl]-N'-[(4-fluorophenyl)methyl]oxamide |
| PubChem CID | 7646586 |
| Molecular Formula | C17H21FN2O4 |
| Molecular Weight | 336.36 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | N-[[(3R)-1,4-dioxaspiro[4.4]nonan-3-yl]methyl]-N'-[(4-fluorophenyl)methyl]oxamide |
| SMILES | O=C(NCc1ccc(F)cc1)C(=O)NC[C@@H]1COC2(CCCC2)O1 |
| InChI | InChI=1S/C17H21FN2O4/c18-13-5-3-12(4-6-13)9-19-15(21)16(22)20-10-14-11-23-17(24-14)7-1-2-8-17/h3-6,14H,1-2,7-11H2,(H,19,21)(H,20,22)/t14-/m1/s1 |
| InChIKey | HHRXLPKMDQZHKU-CQSZACIVSA-N |
| XLogP | 1.24 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.36 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N-[[(3R)-1,4-dioxaspiro[4.4]nonan-3-yl]methyl]-N'-[(4-fluorophenyl)methyl]oxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[(3R)-1,4-dioxaspiro[4.4]nonan-3-yl]methyl]-N'-[(4-fluorophenyl)methyl]oxamide?
The IUPAC name of N-[[(3R)-1,4-dioxaspiro[4.4]nonan-3-yl]methyl]-N'-[(4-fluorophenyl)methyl]oxamide (CID 7646586) is N-[[(3R)-1,4-dioxaspiro[4.4]nonan-3-yl]methyl]-N'-[(4-fluorophenyl)methyl]oxamide.
What is the SMILES notation for N-[[(3R)-1,4-dioxaspiro[4.4]nonan-3-yl]methyl]-N'-[(4-fluorophenyl)methyl]oxamide?
The canonical SMILES for N-[[(3R)-1,4-dioxaspiro[4.4]nonan-3-yl]methyl]-N'-[(4-fluorophenyl)methyl]oxamide is O=C(NCc1ccc(F)cc1)C(=O)NC[C@@H]1COC2(CCCC2)O1.
What is the InChIKey of N-[[(3R)-1,4-dioxaspiro[4.4]nonan-3-yl]methyl]-N'-[(4-fluorophenyl)methyl]oxamide?
The InChIKey is HHRXLPKMDQZHKU-CQSZACIVSA-N. The full InChI is InChI=1S/C17H21FN2O4/c18-13-5-3-12(4-6-13)9-19-15(21)16(22)20-10-14-11-23-17(24-14)7-1-2-8-17/h3-6,14H,1-2,7-11H2,(H,19,21)(H,20,22)/t14-/m1/s1.
What are the key properties of N-[[(3R)-1,4-dioxaspiro[4.4]nonan-3-yl]methyl]-N'-[(4-fluorophenyl)methyl]oxamide?
N-[[(3R)-1,4-dioxaspiro[4.4]nonan-3-yl]methyl]-N'-[(4-fluorophenyl)methyl]oxamide has a molecular weight of 336.36 g/mol, XLogP of 1.24, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[(3R)-1,4-dioxaspiro[4.4]nonan-3-yl]methyl]-N'-[(4-fluorophenyl)methyl]oxamide is sourced from PubChem (CID 7646586), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).