C20H17N3O2 — CID 7646754
3-benzyl-2,10-dimethylpyrimido[4,5-b]quinoline-4,5-dione (PubChem CID 7646754) has the molecular formula C20H17N3O2 and a molecular weight of 331.38 g/mol. Its IUPAC name is 3-benzyl-2,10-dimethylpyrimido[4,5-b]quinoline-4,5-dione.
| Compound Name | 3-benzyl-2,10-dimethylpyrimido[4,5-b]quinoline-4,5-dione |
|---|---|
| PubChem CID | 7646754 |
| Molecular Formula | C20H17N3O2 |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.13 |
| IUPAC Name | 3-benzyl-2,10-dimethylpyrimido[4,5-b]quinoline-4,5-dione |
| SMILES | Cc1nc2c(c(=O)c3ccccc3n2C)c(=O)n1Cc1ccccc1 |
| InChI | InChI=1S/C20H17N3O2/c1-13-21-19-17(18(24)15-10-6-7-11-16(15)22(19)2)20(25)23(13)12-14-8-4-3-5-9-14/h3-11H,12H2,1-2H3 |
| InChIKey | JMFKZAYEBNAGIF-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 56.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|