C24H22N3O2+ — CID 7646770
16-amino-14-(4-methylphenyl)-4,8-dioxa-17-azoniatetracyclo[9.8.0.03,9.012,17]nonadeca-1,3(9),10,12(17),13,15-hexaene-15-carbonitrile (PubChem CID 7646770) has the molecular formula C24H22N3O2+ and a molecular weight of 384.46 g/mol. Its IUPAC name is 16-amino-14-(4-methylphenyl)-4,8-dioxa-17-azoniatetracyclo[9.8.0.03,9.012,17]nonadeca-1,3(9),10,12(17),13,15-hexaene-15-carbonitrile.
| Compound Name | 16-amino-14-(4-methylphenyl)-4,8-dioxa-17-azoniatetracyclo[9.8.0.03,9.012,17]nonadeca-1,3(9),10,12(17),13,15-hexaene-15-carbonitrile |
|---|---|
| PubChem CID | 7646770 |
| Molecular Formula | C24H22N3O2+ |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | 16-amino-14-(4-methylphenyl)-4,8-dioxa-17-azoniatetracyclo[9.8.0.03,9.012,17]nonadeca-1,3(9),10,12(17),13,15-hexaene-15-carbonitrile |
| SMILES | Cc1ccc(-c2cc3[n+](c(N)c2C#N)CCc2cc4c(cc2-3)OCCCO4)cc1 |
| InChI | InChI=1S/C24H21N3O2/c1-15-3-5-16(6-4-15)18-12-21-19-13-23-22(28-9-2-10-29-23)11-17(19)7-8-27(21)24(26)20(18)14-25/h3-6,11-13,26H,2,7-10H2,1H3/p+1 |
| InChIKey | XCFCCNKGCZOUDL-UHFFFAOYSA-O |
| XLogP | 3.79 |
| TPSA | 72.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|