C20H23N5O2S — CID 7647359
N-[(4-ethoxyphenyl)methyl]-N-methyl-2-[1-(2-methylphenyl)tetrazol-5-yl]sulfanylacetamide (PubChem CID 7647359) has the molecular formula C20H23N5O2S and a molecular weight of 397.50 g/mol. Its IUPAC name is N-[(4-ethoxyphenyl)methyl]-N-methyl-2-[1-(2-methylphenyl)tetrazol-5-yl]sulfanylacetamide.
| Compound Name | N-[(4-ethoxyphenyl)methyl]-N-methyl-2-[1-(2-methylphenyl)tetrazol-5-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 7647359 |
| Molecular Formula | C20H23N5O2S |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | N-[(4-ethoxyphenyl)methyl]-N-methyl-2-[1-(2-methylphenyl)tetrazol-5-yl]sulfanylacetamide |
| SMILES | CCOc1ccc(CN(C)C(=O)CSc2nnnn2-c2ccccc2C)cc1 |
| InChI | InChI=1S/C20H23N5O2S/c1-4-27-17-11-9-16(10-12-17)13-24(3)19(26)14-28-20-21-22-23-25(20)18-8-6-5-7-15(18)2/h5-12H,4,13-14H2,1-3H3 |
| InChIKey | ONQHDWRQZQWMPN-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 73.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |