C16H16N2O3 — CID 764788
(2Z)-2-(1,3-benzodioxol-5-ylmethylidene)-6,7,8,9-tetrahydro-5H-imidazo[1,2-a]azepin-3-one (PubChem CID 764788) has the molecular formula C16H16N2O3 and a molecular weight of 284.32 g/mol. Its IUPAC name is (2Z)-2-(1,3-benzodioxol-5-ylmethylidene)-6,7,8,9-tetrahydro-5H-imidazo[1,2-a]azepin-3-one.
| Compound Name | (2Z)-2-(1,3-benzodioxol-5-ylmethylidene)-6,7,8,9-tetrahydro-5H-imidazo[1,2-a]azepin-3-one |
|---|---|
| PubChem CID | 764788 |
| Molecular Formula | C16H16N2O3 |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | (2Z)-2-(1,3-benzodioxol-5-ylmethylidene)-6,7,8,9-tetrahydro-5H-imidazo[1,2-a]azepin-3-one |
| SMILES | O=C1/C(=C/c2ccc3c(c2)OCO3)N=C2CCCCCN12 |
| InChI | InChI=1S/C16H16N2O3/c19-16-12(17-15-4-2-1-3-7-18(15)16)8-11-5-6-13-14(9-11)21-10-20-13/h5-6,8-9H,1-4,7,10H2/b12-8- |
| InChIKey | UPYBEVNNQTZKOS-WQLSENKSSA-N |
| XLogP | 2.57 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|