C12H20NO+ — CID 7648012
(2R,5R)-2,5-dimethyl-1-(2-methylbut-3-yn-2-yl)piperidin-1-ium-4-one (PubChem CID 7648012) has the molecular formula C12H20NO+ and a molecular weight of 194.30 g/mol. Its IUPAC name is (2R,5R)-2,5-dimethyl-1-(2-methylbut-3-yn-2-yl)piperidin-1-ium-4-one.
| Compound Name | (2R,5R)-2,5-dimethyl-1-(2-methylbut-3-yn-2-yl)piperidin-1-ium-4-one |
|---|---|
| PubChem CID | 7648012 |
| Molecular Formula | C12H20NO+ |
| Molecular Weight | 194.30 g/mol |
| Exact Mass | 194.15 |
| IUPAC Name | (2R,5R)-2,5-dimethyl-1-(2-methylbut-3-yn-2-yl)piperidin-1-ium-4-one |
| SMILES | C#CC(C)(C)[NH+]1C[C@@H](C)C(=O)C[C@H]1C |
| InChI | InChI=1S/C12H19NO/c1-6-12(4,5)13-8-9(2)11(14)7-10(13)3/h1,9-10H,7-8H2,2-5H3/p+1/t9-,10-/m1/s1 |
| InChIKey | XJWSYBLWKPQVSC-NXEZZACHSA-O |
| XLogP | 0.28 |
| TPSA | 21.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.30 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|